C17H26O2 — CID 156682405
2-(2-bicyclo[2.2.2]oct-5-enyl)propan-2-yl cyclopentanecarboxylate (PubChem CID 156682405) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.2]oct-5-enyl)propan-2-yl cyclopentanecarboxylate.
| Compound Name | 2-(2-bicyclo[2.2.2]oct-5-enyl)propan-2-yl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 156682405 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-(2-bicyclo[2.2.2]oct-5-enyl)propan-2-yl cyclopentanecarboxylate |
| SMILES | CC(C)(OC(=O)C1CCCC1)C1CC2C=CC1CC2 |
| InChI | InChI=1S/C17H26O2/c1-17(2,19-16(18)14-5-3-4-6-14)15-11-12-7-9-13(15)10-8-12/h7,9,12-15H,3-6,8,10-11H2,1-2H3 |
| InChIKey | IWCZDIVKEHZPHP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|