C20H32O5 — CID 22616790
1-O-(2-bicyclo[2.2.2]oct-5-enyl) 3-O-(3-hydroxy-2,2,4,4-tetramethylpentan-3-yl) propanedioate (PubChem CID 22616790) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is 1-O-(2-bicyclo[2.2.2]oct-5-enyl) 3-O-(3-hydroxy-2,2,4,4-tetramethylpentan-3-yl) propanedioate.
| Compound Name | 1-O-(2-bicyclo[2.2.2]oct-5-enyl) 3-O-(3-hydroxy-2,2,4,4-tetramethylpentan-3-yl) propanedioate |
|---|---|
| PubChem CID | 22616790 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 1-O-(2-bicyclo[2.2.2]oct-5-enyl) 3-O-(3-hydroxy-2,2,4,4-tetramethylpentan-3-yl) propanedioate |
| SMILES | CC(C)(C)C(O)(OC(=O)CC(=O)OC1CC2C=CC1CC2)C(C)(C)C |
| InChI | InChI=1S/C20H32O5/c1-18(2,3)20(23,19(4,5)6)25-17(22)12-16(21)24-15-11-13-7-9-14(15)10-8-13/h7,9,13-15,23H,8,10-12H2,1-6H3 |
| InChIKey | LMWWNEHSDGWNLU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|