C10H12F3NO4S — CID 159476126
2-bicyclo[2.2.1]hept-5-enyl 2-(trifluoromethylsulfonylamino)acetate (PubChem CID 159476126) has the molecular formula C10H12F3NO4S and a molecular weight of 299.27 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enyl 2-(trifluoromethylsulfonylamino)acetate.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enyl 2-(trifluoromethylsulfonylamino)acetate |
|---|---|
| PubChem CID | 159476126 |
| Molecular Formula | C10H12F3NO4S |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enyl 2-(trifluoromethylsulfonylamino)acetate |
| SMILES | O=C(CNS(=O)(=O)C(F)(F)F)OC1CC2C=CC1C2 |
| InChI | InChI=1S/C10H12F3NO4S/c11-10(12,13)19(16,17)14-5-9(15)18-8-4-6-1-2-7(8)3-6/h1-2,6-8,14H,3-5H2 |
| InChIKey | LWKCEQOXLHTZGY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|