C12H14F6O — CID 59080048
(5S)-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propoxy]bicyclo[2.2.1]hept-2-ene (PubChem CID 59080048) has the molecular formula C12H14F6O and a molecular weight of 288.23 g/mol. Its IUPAC name is (5S)-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propoxy]bicyclo[2.2.1]hept-2-ene.
| Compound Name | (5S)-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propoxy]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 59080048 |
| Molecular Formula | C12H14F6O |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (5S)-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propoxy]bicyclo[2.2.1]hept-2-ene |
| SMILES | CC(CO[C@H]1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6O/c1-10(11(13,14)15,12(16,17)18)6-19-9-5-7-2-3-8(9)4-7/h2-3,7-9H,4-6H2,1H3/t7?,8?,9-/m0/s1 |
| InChIKey | SDFLHCFKARDNCX-HACHORDNSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|