C29H36F12O7 — CID 161134784
[2-(2-bicyclo[2.2.1]hept-5-enyloxymethyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] tert-butyl carbonate;5-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]bicyclo[2.2.1]hept-2-ene (PubChem CID 161134784) has the molecular formula C29H36F12O7 and a molecular weight of 724.58 g/mol. Its IUPAC name is [2-(2-bicyclo[2.2.1]hept-5-enyloxymethyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] tert-butyl carbonate;5-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]bicyclo[2.2.1]hept-2-ene.
| Compound Name | [2-(2-bicyclo[2.2.1]hept-5-enyloxymethyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] tert-butyl carbonate;5-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 161134784 |
| Molecular Formula | C29H36F12O7 |
| Molecular Weight | 724.58 g/mol |
| Exact Mass | 724.23 |
| IUPAC Name | [2-(2-bicyclo[2.2.1]hept-5-enyloxymethyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] tert-butyl carbonate;5-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]bicyclo[2.2.1]hept-2-ene |
| SMILES | CC(C)(C)OC(=O)OC(COC1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F.COCOC(COC1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H20F6O4.C13H16F6O3/c1-13(2,3)25-12(23)26-14(15(17,18)19,16(20,21)22)8-24-11-7-9-4-5-10(11)6-9;1-20-7-22-11(12(14,15)16,13(17,18)19)6-21-10-5-8-2-3-9(10)4-8/h4-5,9-11H,6-8H2,1-3H3;2-3,8-10H,4-7H2,1H3 |
| InChIKey | UMQNHJHLVZSVOM-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.58 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|