C9H14O2 — CID 101216179
(1S,4S,5S)-5-(methoxymethoxy)bicyclo[2.2.1]hept-2-ene (PubChem CID 101216179) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (1S,4S,5S)-5-(methoxymethoxy)bicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4S,5S)-5-(methoxymethoxy)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 101216179 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (1S,4S,5S)-5-(methoxymethoxy)bicyclo[2.2.1]hept-2-ene |
| SMILES | COCO[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C9H14O2/c1-10-6-11-9-5-7-2-3-8(9)4-7/h2-3,7-9H,4-6H2,1H3/t7-,8+,9-/m0/s1 |
| InChIKey | VPGUPIAJSYLNLF-YIZRAAEISA-N |
| XLogP | 1.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|