C28H44O8 — CID 102508315
(1S,4R,5S)-5-[[4-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]phenyl]methoxy]bicyclo[2.2.1]hept-2-ene (PubChem CID 102508315) has the molecular formula C28H44O8 and a molecular weight of 508.65 g/mol. Its IUPAC name is (1S,4R,5S)-5-[[4-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]phenyl]methoxy]bicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4R,5S)-5-[[4-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]phenyl]methoxy]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 102508315 |
| Molecular Formula | C28H44O8 |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | (1S,4R,5S)-5-[[4-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]phenyl]methoxy]bicyclo[2.2.1]hept-2-ene |
| SMILES | COCCOCCOCCOCCOCCOCCOCc1ccc(CO[C@H]2C[C@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C28H44O8/c1-29-8-9-30-10-11-31-12-13-32-14-15-33-16-17-34-18-19-35-22-24-2-4-25(5-3-24)23-36-28-21-26-6-7-27(28)20-26/h2-7,26-28H,8-23H2,1H3/t26-,27-,28-/m0/s1 |
| InChIKey | YYDUHNSDPWIRSX-KCHLEUMXSA-N |
| XLogP | 3.41 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|