About bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane
bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane (PubChem CID 67499991) has the molecular formula C13H28O2Si2
and a molecular weight of 272.54 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane |
| PubChem CID | 67499991 |
| Molecular Formula | C13H28O2Si2 |
| Molecular Weight | 272.54 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane |
| SMILES | C[Si](C)(C)O[Si](C)(C)C.OC1CC2C=CC1C2 |
| InChI | InChI=1S/C7H10O.C6H18OSi2/c8-7-4-5-1-2-6(7)3-5;1-8(2,3)7-9(4,5)6/h1-2,5-8H,3-4H2;1-6H3 |
| InChIKey | SMNAKYVKUSWUFO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane?
The IUPAC name of bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane (CID 67499991) is bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane.
What is the SMILES notation for bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane?
The canonical SMILES for bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane is C[Si](C)(C)O[Si](C)(C)C.OC1CC2C=CC1C2.
What is the InChIKey of bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane?
The InChIKey is SMNAKYVKUSWUFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O.C6H18OSi2/c8-7-4-5-1-2-6(7)3-5;1-8(2,3)7-9(4,5)6/h1-2,5-8H,3-4H2;1-6H3.
What are the key properties of bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane?
bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane has a molecular weight of 272.54 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-5-en-2-ol;trimethyl(trimethylsilyloxy)silane is sourced from PubChem (CID 67499991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).