About 2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron
2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron (PubChem CID 174509908) has the molecular formula C9H17O2Si+
and a molecular weight of 185.32 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron |
| PubChem CID | 174509908 |
| Molecular Formula | C9H17O2Si+ |
| Molecular Weight | 185.32 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron |
| SMILES | CO[SiH](OC)C1CC2C=CC1C2.[H+] |
| InChI | InChI=1S/C9H16O2Si/c1-10-12(11-2)9-6-7-3-4-8(9)5-7/h3-4,7-9,12H,5-6H2,1-2H3/p+1 |
| InChIKey | QZNUGGDBXOOFMH-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron?
The IUPAC name of 2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron (CID 174509908) is 2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron.
What is the SMILES notation for 2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron?
The canonical SMILES for 2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron is CO[SiH](OC)C1CC2C=CC1C2.[H+].
What is the InChIKey of 2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron?
The InChIKey is QZNUGGDBXOOFMH-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H16O2Si/c1-10-12(11-2)9-6-7-3-4-8(9)5-7/h3-4,7-9,12H,5-6H2,1-2H3/p+1.
What are the key properties of 2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron?
2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron has a molecular weight of 185.32 g/mol, XLogP of 1.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]hept-5-enyl(dimethoxy)silane;hydron is sourced from PubChem (CID 174509908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).