C9H15O3P — CID 23418938
(1S,4S,5S)-5-dimethoxyphosphorylbicyclo[2.2.1]hept-2-ene (PubChem CID 23418938) has the molecular formula C9H15O3P and a molecular weight of 202.19 g/mol. Its IUPAC name is (1S,4S,5S)-5-dimethoxyphosphorylbicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4S,5S)-5-dimethoxyphosphorylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 23418938 |
| Molecular Formula | C9H15O3P |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (1S,4S,5S)-5-dimethoxyphosphorylbicyclo[2.2.1]hept-2-ene |
| SMILES | COP(=O)(OC)[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C9H15O3P/c1-11-13(10,12-2)9-6-7-3-4-8(9)5-7/h3-4,7-9H,5-6H2,1-2H3/t7-,8+,9-/m0/s1 |
| InChIKey | XRASOJGHWOHRFA-YIZRAAEISA-N |
| XLogP | 2.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|