C9H15B — CID 134979166
[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-dimethylborane (PubChem CID 134979166) has the molecular formula C9H15B and a molecular weight of 134.03 g/mol. Its IUPAC name is [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-dimethylborane.
| Compound Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-dimethylborane |
|---|---|
| PubChem CID | 134979166 |
| Molecular Formula | C9H15B |
| Molecular Weight | 134.03 g/mol |
| Exact Mass | 134.13 |
| IUPAC Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-dimethylborane |
| SMILES | CB(C)[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C9H15B/c1-10(2)9-6-7-3-4-8(9)5-7/h3-4,7-9H,5-6H2,1-2H3/t7-,8+,9-/m0/s1 |
| InChIKey | YZRHDSTVCSSFGY-YIZRAAEISA-N |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.03 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|