C9H13NO — CID 91172290
1-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-methoxymethanimine (PubChem CID 91172290) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-methoxymethanimine.
| Compound Name | 1-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 91172290 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-methoxymethanimine |
| SMILES | CON=CC1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C9H13NO/c1-11-10-6-9-5-7-2-3-8(9)4-7/h2-3,6-9H,4-5H2,1H3/t7-,8+,9?/m0/s1 |
| InChIKey | MXYJJDXZBDMGGX-ZQTLJVIJSA-N |
| XLogP | 1.83 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|