C18H22N4O2 — CID 124764212
N,N'-bis[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]oxamide (PubChem CID 124764212) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N,N'-bis[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]oxamide.
| Compound Name | N,N'-bis[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 124764212 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N,N'-bis[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]oxamide |
| SMILES | O=C(N/N=C\[C@H]1C[C@H]2C=C[C@H]1C2)C(=O)N/N=C\[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C18H22N4O2/c23-17(21-19-9-15-7-11-1-3-13(15)5-11)18(24)22-20-10-16-8-12-2-4-14(16)6-12/h1-4,9-16H,5-8H2,(H,21,23)(H,22,24)/b19-9-,20-10-/t11-,12-,13-,14-,15+,16+/m0/s1 |
| InChIKey | NGTNPOWMSTVRGR-LFLZXYCLSA-N |
| XLogP | 1.61 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|