C22H24N4O3 — CID 100806317
5-N-[(Z)-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-2-N-[(Z)-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]furan-2,5-dicarboxamide (PubChem CID 100806317) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 5-N-[(Z)-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-2-N-[(Z)-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]furan-2,5-dicarboxamide.
| Compound Name | 5-N-[(Z)-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-2-N-[(Z)-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]furan-2,5-dicarboxamide |
|---|---|
| PubChem CID | 100806317 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 5-N-[(Z)-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-2-N-[(Z)-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]furan-2,5-dicarboxamide |
| SMILES | O=C(N/N=C\[C@@H]1C[C@@H]2C=C[C@@H]1C2)c1ccc(C(=O)N/N=C\[C@H]2C[C@H]3C=C[C@@H]2C3)o1 |
| InChI | InChI=1S/C22H24N4O3/c27-21(25-23-11-17-9-13-1-3-15(17)7-13)19-5-6-20(29-19)22(28)26-24-12-18-10-14-2-4-16(18)8-14/h1-6,11-18H,7-10H2,(H,25,27)(H,26,28)/b23-11-,24-12-/t13-,14+,15-,16-,17+,18-/m1/s1 |
| InChIKey | AFAUUXNDJLKADH-LAIMUXHXSA-N |
| XLogP | 3.14 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|