C22H21ClN2OS — CID 18555195
N-[(Z)-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide (PubChem CID 18555195) has the molecular formula C22H21ClN2OS and a molecular weight of 396.94 g/mol. Its IUPAC name is N-[(Z)-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide.
| Compound Name | N-[(Z)-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 18555195 |
| Molecular Formula | C22H21ClN2OS |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[(Z)-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide |
| SMILES | O=C(N/N=C\[C@@H]1C[C@H]2C=C[C@H]1C2)c1ccc(CSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H21ClN2OS/c23-20-7-9-21(10-8-20)27-14-15-1-4-17(5-2-15)22(26)25-24-13-19-12-16-3-6-18(19)11-16/h1-10,13,16,18-19H,11-12,14H2,(H,25,26)/b24-13-/t16-,18-,19-/m0/s1 |
| InChIKey | QGTBQSHZWQMDNC-VGJLURDQSA-N |
| XLogP | 5.56 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|