C18H21N3O2 — CID 129440279
N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-4-(propanoylamino)benzamide (PubChem CID 129440279) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-4-(propanoylamino)benzamide.
| Compound Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-4-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 129440279 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-4-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)NN=C[C@@H]2C[C@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-2-17(22)20-16-7-5-13(6-8-16)18(23)21-19-11-15-10-12-3-4-14(15)9-12/h3-8,11-12,14-15H,2,9-10H2,1H3,(H,20,22)(H,21,23)/t12-,14-,15-/m0/s1 |
| InChIKey | RSRSUKQEJAHXKM-QEJZJMRPSA-N |
| XLogP | 2.96 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|