C19H32N2O — CID 4146094
N-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)undecanamide (PubChem CID 4146094) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)undecanamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)undecanamide |
|---|---|
| PubChem CID | 4146094 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)undecanamide |
| SMILES | CCCCCCCCCCC(=O)NN=CC1CC2C=CC1C2 |
| InChI | InChI=1S/C19H32N2O/c1-2-3-4-5-6-7-8-9-10-19(22)21-20-15-18-14-16-11-12-17(18)13-16/h11-12,15-18H,2-10,13-14H2,1H3,(H,21,22) |
| InChIKey | HEDIAHVRAQITEO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|