About bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride
bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride (PubChem CID 90067805) has the molecular formula C24H40Cl2O2
and a molecular weight of 431.49 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride |
| PubChem CID | 90067805 |
| Molecular Formula | C24H40Cl2O2 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride |
| SMILES | CCCCCCCCCCCCCCCC(=O)Cl.O=C(Cl)C1CC2C=CC1C2 |
| InChI | InChI=1S/C16H31ClO.C8H9ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;9-8(10)7-4-5-1-2-6(7)3-5/h2-15H2,1H3;1-2,5-7H,3-4H2 |
| InChIKey | YHMPLCJXRQGFTM-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride?
The IUPAC name of bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride (CID 90067805) is bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride.
What is the SMILES notation for bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride?
The canonical SMILES for bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride is CCCCCCCCCCCCCCCC(=O)Cl.O=C(Cl)C1CC2C=CC1C2.
What is the InChIKey of bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride?
The InChIKey is YHMPLCJXRQGFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31ClO.C8H9ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;9-8(10)7-4-5-1-2-6(7)3-5/h2-15H2,1H3;1-2,5-7H,3-4H2.
What are the key properties of bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride?
bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride has a molecular weight of 431.49 g/mol, XLogP of 8.20, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-5-ene-2-carbonyl chloride;hexadecanoyl chloride is sourced from PubChem (CID 90067805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).