About cyclohexane;octanoyl chloride
cyclohexane;octanoyl chloride (PubChem CID 175478267) has the molecular formula C14H27ClO
and a molecular weight of 246.82 g/mol. Its IUPAC name is cyclohexane;octanoyl chloride.
Molecular Properties
| Compound Name | cyclohexane;octanoyl chloride |
| PubChem CID | 175478267 |
| Molecular Formula | C14H27ClO |
| Molecular Weight | 246.82 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | cyclohexane;octanoyl chloride |
| SMILES | C1CCCCC1.CCCCCCCC(=O)Cl |
| InChI | InChI=1S/C8H15ClO.C6H12/c1-2-3-4-5-6-7-8(9)10;1-2-4-6-5-3-1/h2-7H2,1H3;1-6H2 |
| InChIKey | UKWLITUVUQTYMG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.82 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;octanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;octanoyl chloride?
The IUPAC name of cyclohexane;octanoyl chloride (CID 175478267) is cyclohexane;octanoyl chloride.
What is the SMILES notation for cyclohexane;octanoyl chloride?
The canonical SMILES for cyclohexane;octanoyl chloride is C1CCCCC1.CCCCCCCC(=O)Cl.
What is the InChIKey of cyclohexane;octanoyl chloride?
The InChIKey is UKWLITUVUQTYMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO.C6H12/c1-2-3-4-5-6-7-8(9)10;1-2-4-6-5-3-1/h2-7H2,1H3;1-6H2.
What are the key properties of cyclohexane;octanoyl chloride?
cyclohexane;octanoyl chloride has a molecular weight of 246.82 g/mol, XLogP of 5.45, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;octanoyl chloride is sourced from PubChem (CID 175478267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).