C21H19ClN2OS — CID 6143286
N-[(Z)-6-bicyclo[3.2.0]hept-3-enylideneamino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide (PubChem CID 6143286) has the molecular formula C21H19ClN2OS and a molecular weight of 382.92 g/mol. Its IUPAC name is N-[(Z)-6-bicyclo[3.2.0]hept-3-enylideneamino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide.
| Compound Name | N-[(Z)-6-bicyclo[3.2.0]hept-3-enylideneamino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 6143286 |
| Molecular Formula | C21H19ClN2OS |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[(Z)-6-bicyclo[3.2.0]hept-3-enylideneamino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide |
| SMILES | O=C(N/N=C1/CC2CC=CC12)c1ccc(CSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H19ClN2OS/c22-17-8-10-18(11-9-17)26-13-14-4-6-15(7-5-14)21(25)24-23-20-12-16-2-1-3-19(16)20/h1,3-11,16,19H,2,12-13H2,(H,24,25)/b23-20- |
| InChIKey | WRSMDMRLTBGRTP-ATJXCDBQSA-N |
| XLogP | 5.31 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|