C21H19ClN2O2 — CID 9408998
N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-4-[(4-chlorophenoxy)methyl]benzamide (PubChem CID 9408998) has the molecular formula C21H19ClN2O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-4-[(4-chlorophenoxy)methyl]benzamide.
| Compound Name | N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-4-[(4-chlorophenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 9408998 |
| Molecular Formula | C21H19ClN2O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-4-[(4-chlorophenoxy)methyl]benzamide |
| SMILES | O=C(N/N=C1/C[C@@H]2C=CC[C@@H]12)c1ccc(COc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H19ClN2O2/c22-17-8-10-18(11-9-17)26-13-14-4-6-15(7-5-14)21(25)24-23-20-12-16-2-1-3-19(16)20/h1-2,4-11,16,19H,3,12-13H2,(H,24,25)/b23-20-/t16-,19+/m0/s1 |
| InChIKey | RUPYEOKBKBBJAS-BPZWCHMKSA-N |
| XLogP | 4.60 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|