C25H28N2O2 — CID 7957907
N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-4-[(4-tert-butylphenoxy)methyl]benzamide (PubChem CID 7957907) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-4-[(4-tert-butylphenoxy)methyl]benzamide.
| Compound Name | N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-4-[(4-tert-butylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 7957907 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-4-[(4-tert-butylphenoxy)methyl]benzamide |
| SMILES | CC(C)(C)c1ccc(OCc2ccc(C(=O)N/N=C3/C[C@H]4CC=C[C@H]34)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O2/c1-25(2,3)20-11-13-21(14-12-20)29-16-17-7-9-18(10-8-17)24(28)27-26-23-15-19-5-4-6-22(19)23/h4,6-14,19,22H,5,15-16H2,1-3H3,(H,27,28)/b26-23-/t19-,22+/m1/s1 |
| InChIKey | GRALOGQPOHSRSM-QIQDNZLUSA-N |
| XLogP | 5.24 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|