About N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide
N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide (PubChem CID 7939655) has the molecular formula C14H13ClN2O
and a molecular weight of 260.72 g/mol. Its IUPAC name is N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide.
Molecular Properties
| Compound Name | N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide |
| PubChem CID | 7939655 |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide |
| SMILES | O=C(N/N=C1/C[C@H]2CC=C[C@@H]12)c1ccccc1Cl |
| InChI | InChI=1S/C14H13ClN2O/c15-12-7-2-1-5-11(12)14(18)17-16-13-8-9-4-3-6-10(9)13/h1-3,5-7,9-10H,4,8H2,(H,17,18)/b16-13-/t9-,10-/m1/s1 |
| InChIKey | XDJIYQIZDCYLGM-WBVUFQPPSA-N |
| XLogP | 3.02 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide?
The IUPAC name of N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide (CID 7939655) is N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide.
What is the SMILES notation for N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide?
The canonical SMILES for N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide is O=C(N/N=C1/C[C@H]2CC=C[C@@H]12)c1ccccc1Cl.
What is the InChIKey of N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide?
The InChIKey is XDJIYQIZDCYLGM-WBVUFQPPSA-N. The full InChI is InChI=1S/C14H13ClN2O/c15-12-7-2-1-5-11(12)14(18)17-16-13-8-9-4-3-6-10(9)13/h1-3,5-7,9-10H,4,8H2,(H,17,18)/b16-13-/t9-,10-/m1/s1.
What are the key properties of N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide?
N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide has a molecular weight of 260.72 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-2-chlorobenzamide is sourced from PubChem (CID 7939655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).