C19H24N4O2 — CID 4155511
N,N'-bis(6-bicyclo[3.2.0]hept-3-enylideneamino)pentanediamide (PubChem CID 4155511) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N,N'-bis(6-bicyclo[3.2.0]hept-3-enylideneamino)pentanediamide.
| Compound Name | N,N'-bis(6-bicyclo[3.2.0]hept-3-enylideneamino)pentanediamide |
|---|---|
| PubChem CID | 4155511 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N,N'-bis(6-bicyclo[3.2.0]hept-3-enylideneamino)pentanediamide |
| SMILES | O=C(CCCC(=O)NN=C1CC2CC=CC12)NN=C1CC2CC=CC12 |
| InChI | InChI=1S/C19H24N4O2/c24-18(22-20-16-10-12-4-1-6-14(12)16)8-3-9-19(25)23-21-17-11-13-5-2-7-15(13)17/h1-2,6-7,12-15H,3-5,8-11H2,(H,22,24)(H,23,25) |
| InChIKey | SPYVKROHLSFMFH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|