C21H28N4O2 — CID 3536131
N,N'-bis(6-bicyclo[3.2.0]hept-3-enylideneamino)heptanediamide (PubChem CID 3536131) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N,N'-bis(6-bicyclo[3.2.0]hept-3-enylideneamino)heptanediamide.
| Compound Name | N,N'-bis(6-bicyclo[3.2.0]hept-3-enylideneamino)heptanediamide |
|---|---|
| PubChem CID | 3536131 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N,N'-bis(6-bicyclo[3.2.0]hept-3-enylideneamino)heptanediamide |
| SMILES | O=C(CCCCCC(=O)NN=C1CC2CC=CC12)NN=C1CC2CC=CC12 |
| InChI | InChI=1S/C21H28N4O2/c26-20(24-22-18-12-14-6-4-8-16(14)18)10-2-1-3-11-21(27)25-23-19-13-15-7-5-9-17(15)19/h4-5,8-9,14-17H,1-3,6-7,10-13H2,(H,24,26)(H,25,27) |
| InChIKey | SXKAAWNQVZBUID-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|