C22H30N4O2 — CID 4517496
N,N'-bis(6-bicyclo[3.2.0]hept-3-enylideneamino)octanediamide (PubChem CID 4517496) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N,N'-bis(6-bicyclo[3.2.0]hept-3-enylideneamino)octanediamide.
| Compound Name | N,N'-bis(6-bicyclo[3.2.0]hept-3-enylideneamino)octanediamide |
|---|---|
| PubChem CID | 4517496 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N,N'-bis(6-bicyclo[3.2.0]hept-3-enylideneamino)octanediamide |
| SMILES | O=C(CCCCCCC(=O)NN=C1CC2CC=CC12)NN=C1CC2CC=CC12 |
| InChI | InChI=1S/C22H30N4O2/c27-21(25-23-19-13-15-7-5-9-17(15)19)11-3-1-2-4-12-22(28)26-24-20-14-16-8-6-10-18(16)20/h5-6,9-10,15-18H,1-4,7-8,11-14H2,(H,25,27)(H,26,28) |
| InChIKey | YNNGUIAZNLPCCA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|