C13H10F12O2 — CID 58743430
3-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,4,4,4-hexafluoro-2,3-bis(trifluoromethyl)butan-2-ol (PubChem CID 58743430) has the molecular formula C13H10F12O2 and a molecular weight of 426.20 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,4,4,4-hexafluoro-2,3-bis(trifluoromethyl)butan-2-ol.
| Compound Name | 3-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,4,4,4-hexafluoro-2,3-bis(trifluoromethyl)butan-2-ol |
|---|---|
| PubChem CID | 58743430 |
| Molecular Formula | C13H10F12O2 |
| Molecular Weight | 426.20 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,4,4,4-hexafluoro-2,3-bis(trifluoromethyl)butan-2-ol |
| SMILES | OC(C(F)(F)F)(C(F)(F)F)C(OC1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H10F12O2/c14-10(15,16)8(26,11(17,18)19)9(12(20,21)22,13(23,24)25)27-7-4-5-1-2-6(7)3-5/h1-2,5-7,26H,3-4H2 |
| InChIKey | OSBGTYCWAYUUSP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.20 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|