C19H18F16O2 — CID 58743456
8-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,2,2,9,9,10,10,10-decafluoro-3,8-bis(trifluoromethyl)decan-3-ol (PubChem CID 58743456) has the molecular formula C19H18F16O2 and a molecular weight of 582.32 g/mol. Its IUPAC name is 8-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,2,2,9,9,10,10,10-decafluoro-3,8-bis(trifluoromethyl)decan-3-ol.
| Compound Name | 8-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,2,2,9,9,10,10,10-decafluoro-3,8-bis(trifluoromethyl)decan-3-ol |
|---|---|
| PubChem CID | 58743456 |
| Molecular Formula | C19H18F16O2 |
| Molecular Weight | 582.32 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | 8-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,2,2,9,9,10,10,10-decafluoro-3,8-bis(trifluoromethyl)decan-3-ol |
| SMILES | OC(CCCCC(OC1CC2C=CC1C2)(C(F)(F)F)C(F)(F)C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H18F16O2/c20-14(21,18(30,31)32)12(36,16(24,25)26)5-1-2-6-13(17(27,28)29,15(22,23)19(33,34)35)37-11-8-9-3-4-10(11)7-9/h3-4,9-11,36H,1-2,5-8H2 |
| InChIKey | QNZVZUXMODTWOE-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.32 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|