C9H10F5NO2S — CID 87415341
N-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,2,2,2-pentafluoroethanesulfonamide (PubChem CID 87415341) has the molecular formula C9H10F5NO2S and a molecular weight of 291.24 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,2,2,2-pentafluoroethanesulfonamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,2,2,2-pentafluoroethanesulfonamide |
|---|---|
| PubChem CID | 87415341 |
| Molecular Formula | C9H10F5NO2S |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,2,2,2-pentafluoroethanesulfonamide |
| SMILES | O=S(=O)(NC1CC2C=CC1C2)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F5NO2S/c10-8(11,12)9(13,14)18(16,17)15-7-4-5-1-2-6(7)3-5/h1-2,5-7,15H,3-4H2 |
| InChIKey | GLSJZJSPOLVERS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|