C12H19N — CID 130917733
(1R,4R)-N-cyclopentylbicyclo[2.2.1]hept-5-en-2-amine (PubChem CID 130917733) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (1R,4R)-N-cyclopentylbicyclo[2.2.1]hept-5-en-2-amine.
| Compound Name | (1R,4R)-N-cyclopentylbicyclo[2.2.1]hept-5-en-2-amine |
|---|---|
| PubChem CID | 130917733 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (1R,4R)-N-cyclopentylbicyclo[2.2.1]hept-5-en-2-amine |
| SMILES | C1=C[C@H]2C[C@@H]1CC2NC1CCCC1 |
| InChI | InChI=1S/C12H19N/c1-2-4-11(3-1)13-12-8-9-5-6-10(12)7-9/h5-6,9-13H,1-4,7-8H2/t9-,10+,12?/m1/s1 |
| InChIKey | SRYOMHOWOKCFMP-WFCWDVHWSA-N |
| XLogP | 2.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|