C12H21N — CID 130643782
(1R,4R)-N-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-5-en-2-amine (PubChem CID 130643782) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (1R,4R)-N-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-5-en-2-amine.
| Compound Name | (1R,4R)-N-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-5-en-2-amine |
|---|---|
| PubChem CID | 130643782 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (1R,4R)-N-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-5-en-2-amine |
| SMILES | CC(C)(C)CNC1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C12H21N/c1-12(2,3)8-13-11-7-9-4-5-10(11)6-9/h4-5,9-11,13H,6-8H2,1-3H3/t9-,10+,11?/m1/s1 |
| InChIKey | RTWKXUOADXNEBA-JKIOLJMWSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|