C13H18N2S — CID 98080335
1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(2-methylbut-3-yn-2-yl)thiourea (PubChem CID 98080335) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(2-methylbut-3-yn-2-yl)thiourea.
| Compound Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(2-methylbut-3-yn-2-yl)thiourea |
|---|---|
| PubChem CID | 98080335 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(2-methylbut-3-yn-2-yl)thiourea |
| SMILES | C#CC(C)(C)NC(=S)N[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C13H18N2S/c1-4-13(2,3)15-12(16)14-11-8-9-5-6-10(11)7-9/h1,5-6,9-11H,7-8H2,2-3H3,(H2,14,15,16)/t9-,10-,11-/m0/s1 |
| InChIKey | UIDQKOBVPFVHFS-DCAQKATOSA-N |
| XLogP | 1.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|