C15H17ClN4S2 — CID 51378148
1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(2-chlorophenyl)carbamothioylamino]thiourea (PubChem CID 51378148) has the molecular formula C15H17ClN4S2 and a molecular weight of 352.92 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(2-chlorophenyl)carbamothioylamino]thiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(2-chlorophenyl)carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 51378148 |
| Molecular Formula | C15H17ClN4S2 |
| Molecular Weight | 352.92 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(2-chlorophenyl)carbamothioylamino]thiourea |
| SMILES | S=C(NNC(=S)N[C@H]1C[C@H]2C=C[C@@H]1C2)Nc1ccccc1Cl |
| InChI | InChI=1S/C15H17ClN4S2/c16-11-3-1-2-4-12(11)17-14(21)19-20-15(22)18-13-8-9-5-6-10(13)7-9/h1-6,9-10,13H,7-8H2,(H2,17,19,21)(H2,18,20,22)/t9-,10+,13-/m0/s1 |
| InChIKey | VFDHUCREADMVIA-CWSCBRNRSA-N |
| XLogP | 2.97 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.92 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|