C22H24N2S — CID 98080271
1-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(1S)-1,2-diphenylethyl]thiourea (PubChem CID 98080271) has the molecular formula C22H24N2S and a molecular weight of 348.51 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(1S)-1,2-diphenylethyl]thiourea.
| Compound Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(1S)-1,2-diphenylethyl]thiourea |
|---|---|
| PubChem CID | 98080271 |
| Molecular Formula | C22H24N2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(1S)-1,2-diphenylethyl]thiourea |
| SMILES | S=C(N[C@@H](Cc1ccccc1)c1ccccc1)N[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C22H24N2S/c25-22(24-21-15-17-11-12-19(21)13-17)23-20(18-9-5-2-6-10-18)14-16-7-3-1-4-8-16/h1-12,17,19-21H,13-15H2,(H2,23,24,25)/t17-,19-,20-,21+/m0/s1 |
| InChIKey | UOCRDSBKJFJJCQ-ZIBCJSCZSA-N |
| XLogP | 4.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|