C28H28N2OS — CID 99936953
1-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-[2-[(1R)-1-hydroxy-1,2-diphenylethyl]phenyl]thiourea (PubChem CID 99936953) has the molecular formula C28H28N2OS and a molecular weight of 440.61 g/mol. Its IUPAC name is 1-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-[2-[(1R)-1-hydroxy-1,2-diphenylethyl]phenyl]thiourea.
| Compound Name | 1-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-[2-[(1R)-1-hydroxy-1,2-diphenylethyl]phenyl]thiourea |
|---|---|
| PubChem CID | 99936953 |
| Molecular Formula | C28H28N2OS |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 1-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-[2-[(1R)-1-hydroxy-1,2-diphenylethyl]phenyl]thiourea |
| SMILES | O[C@](Cc1ccccc1)(c1ccccc1)c1ccccc1NC(=S)N[C@H]1C[C@@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C28H28N2OS/c31-28(23-11-5-2-6-12-23,19-20-9-3-1-4-10-20)24-13-7-8-14-25(24)29-27(32)30-26-18-21-15-16-22(26)17-21/h1-16,21-22,26,31H,17-19H2,(H2,29,30,32)/t21-,22-,26+,28-/m1/s1 |
| InChIKey | DIKYUFRGYDCKDG-YXFSXQOZSA-N |
| XLogP | 5.42 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|