C16H20N2S — CID 99935997
1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(2-phenylethyl)thiourea (PubChem CID 99935997) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 99935997 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(2-phenylethyl)thiourea |
| SMILES | S=C(NCCc1ccccc1)N[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C16H20N2S/c19-16(17-9-8-12-4-2-1-3-5-12)18-15-11-13-6-7-14(15)10-13/h1-7,13-15H,8-11H2,(H2,17,18,19)/t13-,14+,15-/m0/s1 |
| InChIKey | HDDQQCARXKPJRF-ZNMIVQPWSA-N |
| XLogP | 2.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|