C12H20N4S2 — CID 98083223
1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(propan-2-ylcarbamothioylamino)thiourea (PubChem CID 98083223) has the molecular formula C12H20N4S2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(propan-2-ylcarbamothioylamino)thiourea.
| Compound Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(propan-2-ylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 98083223 |
| Molecular Formula | C12H20N4S2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(propan-2-ylcarbamothioylamino)thiourea |
| SMILES | CC(C)NC(=S)NNC(=S)N[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C12H20N4S2/c1-7(2)13-11(17)15-16-12(18)14-10-6-8-3-4-9(10)5-8/h3-4,7-10H,5-6H2,1-2H3,(H2,13,15,17)(H2,14,16,18)/t8-,9-,10-/m0/s1 |
| InChIKey | SLZXJVNWOVMTDD-GUBZILKMSA-N |
| XLogP | 1.20 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|