C15H16BrClN4S2 — CID 2803558
1-(2-bicyclo[2.2.1]hept-5-enyl)-3-[(4-bromo-3-chlorophenyl)carbamothioylamino]thiourea (PubChem CID 2803558) has the molecular formula C15H16BrClN4S2 and a molecular weight of 431.81 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enyl)-3-[(4-bromo-3-chlorophenyl)carbamothioylamino]thiourea.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-3-[(4-bromo-3-chlorophenyl)carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 2803558 |
| Molecular Formula | C15H16BrClN4S2 |
| Molecular Weight | 431.81 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-3-[(4-bromo-3-chlorophenyl)carbamothioylamino]thiourea |
| SMILES | S=C(NNC(=S)NC1CC2C=CC1C2)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C15H16BrClN4S2/c16-11-4-3-10(7-12(11)17)18-14(22)20-21-15(23)19-13-6-8-1-2-9(13)5-8/h1-4,7-9,13H,5-6H2,(H2,18,20,22)(H2,19,21,23) |
| InChIKey | GAQHIVHFFHJUMD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.81 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|