C15H15Cl2N3S — CID 2823961
1-(2-bicyclo[2.2.1]hept-5-enyl)-3-[(3,4-dichlorophenyl)methylideneamino]thiourea (PubChem CID 2823961) has the molecular formula C15H15Cl2N3S and a molecular weight of 340.28 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enyl)-3-[(3,4-dichlorophenyl)methylideneamino]thiourea.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-3-[(3,4-dichlorophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 2823961 |
| Molecular Formula | C15H15Cl2N3S |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-3-[(3,4-dichlorophenyl)methylideneamino]thiourea |
| SMILES | S=C(NN=Cc1ccc(Cl)c(Cl)c1)NC1CC2C=CC1C2 |
| InChI | InChI=1S/C15H15Cl2N3S/c16-12-4-2-10(6-13(12)17)8-18-20-15(21)19-14-7-9-1-3-11(14)5-9/h1-4,6,8-9,11,14H,5,7H2,(H2,19,20,21) |
| InChIKey | QMBXKKQAQSNTDW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|