C13H15N3S2 — CID 98083182
1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(Z)-thiophen-2-ylmethylideneamino]thiourea (PubChem CID 98083182) has the molecular formula C13H15N3S2 and a molecular weight of 277.42 g/mol. Its IUPAC name is 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(Z)-thiophen-2-ylmethylideneamino]thiourea.
| Compound Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(Z)-thiophen-2-ylmethylideneamino]thiourea |
|---|---|
| PubChem CID | 98083182 |
| Molecular Formula | C13H15N3S2 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(Z)-thiophen-2-ylmethylideneamino]thiourea |
| SMILES | S=C(N/N=C\c1cccs1)N[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C13H15N3S2/c17-13(16-14-8-11-2-1-5-18-11)15-12-7-9-3-4-10(12)6-9/h1-5,8-10,12H,6-7H2,(H2,15,16,17)/b14-8-/t9-,10-,12-/m0/s1 |
| InChIKey | TVHNQUQTSHYCFQ-PBHITVFNSA-N |
| XLogP | 2.51 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|