C17H28N2S — CID 98080277
1-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]thiourea (PubChem CID 98080277) has the molecular formula C17H28N2S and a molecular weight of 292.49 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]thiourea.
| Compound Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 98080277 |
| Molecular Formula | C17H28N2S |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]thiourea |
| SMILES | C[C@@H]1C[C@H](NC(=S)N[C@@H]2C[C@H]3C=C[C@H]2C3)CC(C)(C)C1 |
| InChI | InChI=1S/C17H28N2S/c1-11-6-14(10-17(2,3)9-11)18-16(20)19-15-8-12-4-5-13(15)7-12/h4-5,11-15H,6-10H2,1-3H3,(H2,18,19,20)/t11-,12+,13+,14+,15-/m1/s1 |
| InChIKey | QYTZDQJSDAFAGU-CAEXGNQWSA-N |
| XLogP | 3.63 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|