C18H28N2S — CID 19652677
1-[(4-methylphenyl)methyl]-3-(3,3,5-trimethylcyclohexyl)thiourea (PubChem CID 19652677) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-3-(3,3,5-trimethylcyclohexyl)thiourea.
| Compound Name | 1-[(4-methylphenyl)methyl]-3-(3,3,5-trimethylcyclohexyl)thiourea |
|---|---|
| PubChem CID | 19652677 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-3-(3,3,5-trimethylcyclohexyl)thiourea |
| SMILES | Cc1ccc(CNC(=S)NC2CC(C)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C18H28N2S/c1-13-5-7-15(8-6-13)12-19-17(21)20-16-9-14(2)10-18(3,4)11-16/h5-8,14,16H,9-12H2,1-4H3,(H2,19,20,21) |
| InChIKey | HGJJZFORRDSPIW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|