C18H28N2S — CID 6924822
1-(2,5-dimethylphenyl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]thiourea (PubChem CID 6924822) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]thiourea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 6924822 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)N[C@@H]2C[C@H](C)CC(C)(C)C2)c1 |
| InChI | InChI=1S/C18H28N2S/c1-12-6-7-14(3)16(9-12)20-17(21)19-15-8-13(2)10-18(4,5)11-15/h6-7,9,13,15H,8,10-11H2,1-5H3,(H2,19,20,21)/t13-,15+/m0/s1 |
| InChIKey | ZIPPNSGMFJLGCD-DZGCQCFKSA-N |
| XLogP | 4.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|