C28H40N4S2 — CID 28875163
1-(2,5-dimethylphenyl)-3-[(1S,3R)-3-[[(2,5-dimethylphenyl)carbamothioylamino]methyl]-3,5,5-trimethylcyclohexyl]thiourea (PubChem CID 28875163) has the molecular formula C28H40N4S2 and a molecular weight of 496.79 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[(1S,3R)-3-[[(2,5-dimethylphenyl)carbamothioylamino]methyl]-3,5,5-trimethylcyclohexyl]thiourea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[(1S,3R)-3-[[(2,5-dimethylphenyl)carbamothioylamino]methyl]-3,5,5-trimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 28875163 |
| Molecular Formula | C28H40N4S2 |
| Molecular Weight | 496.79 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[(1S,3R)-3-[[(2,5-dimethylphenyl)carbamothioylamino]methyl]-3,5,5-trimethylcyclohexyl]thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)NC[C@@]2(C)C[C@@H](NC(=S)Nc3cc(C)ccc3C)CC(C)(C)C2)c1 |
| InChI | InChI=1S/C28H40N4S2/c1-18-8-10-20(3)23(12-18)31-25(33)29-17-28(7)15-22(14-27(5,6)16-28)30-26(34)32-24-13-19(2)9-11-21(24)4/h8-13,22H,14-17H2,1-7H3,(H2,29,31,33)(H2,30,32,34)/t22-,28-/m0/s1 |
| InChIKey | RSCWKCRBPYFOID-DWACAAAGSA-N |
| XLogP | 6.78 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.79 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|