C20H30N2O3S — CID 118643317
[3-[[(2,6-dimethylphenoxy)carbothioylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamic acid (PubChem CID 118643317) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is [3-[[(2,6-dimethylphenoxy)carbothioylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamic acid.
| Compound Name | [3-[[(2,6-dimethylphenoxy)carbothioylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 118643317 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [3-[[(2,6-dimethylphenoxy)carbothioylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamic acid |
| SMILES | Cc1cccc(C)c1OC(=S)NCC1(C)CC(NC(=O)O)CC(C)(C)C1 |
| InChI | InChI=1S/C20H30N2O3S/c1-13-7-6-8-14(2)16(13)25-18(26)21-12-20(5)10-15(22-17(23)24)9-19(3,4)11-20/h6-8,15,22H,9-12H2,1-5H3,(H,21,26)(H,23,24) |
| InChIKey | JFXOPMJVEPJFRU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|