C24H30N2O3 — CID 121431628
phenyl N-[(5-benzamido-1,3,3-trimethylcyclohexyl)methyl]carbamate (PubChem CID 121431628) has the molecular formula C24H30N2O3 and a molecular weight of 394.51 g/mol. Its IUPAC name is phenyl N-[(5-benzamido-1,3,3-trimethylcyclohexyl)methyl]carbamate.
| Compound Name | phenyl N-[(5-benzamido-1,3,3-trimethylcyclohexyl)methyl]carbamate |
|---|---|
| PubChem CID | 121431628 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | phenyl N-[(5-benzamido-1,3,3-trimethylcyclohexyl)methyl]carbamate |
| SMILES | CC1(C)CC(NC(=O)c2ccccc2)CC(C)(CNC(=O)Oc2ccccc2)C1 |
| InChI | InChI=1S/C24H30N2O3/c1-23(2)14-19(26-21(27)18-10-6-4-7-11-18)15-24(3,16-23)17-25-22(28)29-20-12-8-5-9-13-20/h4-13,19H,14-17H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | JEDFBNUXIWGDNE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |