C22H33N3O6 — CID 118911933
2-[[1,3,3-trimethyl-5-(2-phenoxyethoxycarbonylamino)cyclohexyl]methylcarbamoylamino]acetic acid (PubChem CID 118911933) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-[[1,3,3-trimethyl-5-(2-phenoxyethoxycarbonylamino)cyclohexyl]methylcarbamoylamino]acetic acid.
| Compound Name | 2-[[1,3,3-trimethyl-5-(2-phenoxyethoxycarbonylamino)cyclohexyl]methylcarbamoylamino]acetic acid |
|---|---|
| PubChem CID | 118911933 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 2-[[1,3,3-trimethyl-5-(2-phenoxyethoxycarbonylamino)cyclohexyl]methylcarbamoylamino]acetic acid |
| SMILES | CC1(C)CC(NC(=O)OCCOc2ccccc2)CC(C)(CNC(=O)NCC(=O)O)C1 |
| InChI | InChI=1S/C22H33N3O6/c1-21(2)11-16(12-22(3,14-21)15-24-19(28)23-13-18(26)27)25-20(29)31-10-9-30-17-7-5-4-6-8-17/h4-8,16H,9-15H2,1-3H3,(H,25,29)(H,26,27)(H2,23,24,28) |
| InChIKey | UCVKZAVEQDCGOW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|