C31H41NO7 — CID 158312663
2-[2-[3,3,5-trimethyl-5-[(2-phenoxyethoxycarbonylamino)methyl]cyclohexyl]acetyl]oxypropyl benzoate (PubChem CID 158312663) has the molecular formula C31H41NO7 and a molecular weight of 539.67 g/mol. Its IUPAC name is 2-[2-[3,3,5-trimethyl-5-[(2-phenoxyethoxycarbonylamino)methyl]cyclohexyl]acetyl]oxypropyl benzoate.
| Compound Name | 2-[2-[3,3,5-trimethyl-5-[(2-phenoxyethoxycarbonylamino)methyl]cyclohexyl]acetyl]oxypropyl benzoate |
|---|---|
| PubChem CID | 158312663 |
| Molecular Formula | C31H41NO7 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | 2-[2-[3,3,5-trimethyl-5-[(2-phenoxyethoxycarbonylamino)methyl]cyclohexyl]acetyl]oxypropyl benzoate |
| SMILES | CC(COC(=O)c1ccccc1)OC(=O)CC1CC(C)(C)CC(C)(CNC(=O)OCCOc2ccccc2)C1 |
| InChI | InChI=1S/C31H41NO7/c1-23(20-38-28(34)25-11-7-5-8-12-25)39-27(33)17-24-18-30(2,3)21-31(4,19-24)22-32-29(35)37-16-15-36-26-13-9-6-10-14-26/h5-14,23-24H,15-22H2,1-4H3,(H,32,35) |
| InChIKey | ARBKTIRUPAQESR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|