C29H39NO8 — CID 149287117
2-(3,4-dihydroxyphenyl)ethyl 2-[3-[[2-(3,4-dihydroxyphenyl)ethoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]acetate (PubChem CID 149287117) has the molecular formula C29H39NO8 and a molecular weight of 529.63 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)ethyl 2-[3-[[2-(3,4-dihydroxyphenyl)ethoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]acetate.
| Compound Name | 2-(3,4-dihydroxyphenyl)ethyl 2-[3-[[2-(3,4-dihydroxyphenyl)ethoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]acetate |
|---|---|
| PubChem CID | 149287117 |
| Molecular Formula | C29H39NO8 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)ethyl 2-[3-[[2-(3,4-dihydroxyphenyl)ethoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]acetate |
| SMILES | CC1(C)CC(CC(=O)OCCc2ccc(O)c(O)c2)CC(C)(CNC(=O)OCCc2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C29H39NO8/c1-28(2)15-21(14-26(35)37-10-8-19-4-6-22(31)24(33)12-19)16-29(3,17-28)18-30-27(36)38-11-9-20-5-7-23(32)25(34)13-20/h4-7,12-13,21,31-34H,8-11,14-18H2,1-3H3,(H,30,36) |
| InChIKey | XUCOCENKAXONKR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|