C14H18O4 — CID 90192242
2-(3,4-dihydroxyphenyl)ethyl (Z)-hex-3-enoate (PubChem CID 90192242) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)ethyl (Z)-hex-3-enoate.
| Compound Name | 2-(3,4-dihydroxyphenyl)ethyl (Z)-hex-3-enoate |
|---|---|
| PubChem CID | 90192242 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)ethyl (Z)-hex-3-enoate |
| SMILES | CC/C=C\CC(=O)OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H18O4/c1-2-3-4-5-14(17)18-9-8-11-6-7-12(15)13(16)10-11/h3-4,6-7,10,15-16H,2,5,8-9H2,1H3/b4-3- |
| InChIKey | RTPJCKSVLMDGMI-ARJAWSKDSA-N |
| XLogP | 2.54 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|